Difference between revisions of "SJ00411"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHOXY-BENZOQUINONE OCTAPRENYL-METHOXY-BENZOQUINONE] == * common-name: ** 2-methoxy...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Release-factor-N5-Methyl-L-glutamine Release-factor-N5-Methyl-L-glutamine] == * common-name: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHOXY-BENZOQUINONE OCTAPRENYL-METHOXY-BENZOQUINONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Release-factor-N5-Methyl-L-glutamine Release-factor-N5-Methyl-L-glutamine] ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol
+
** a [release factor]-n5-methyl-l-glutamine
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c
 
* inchi-key:
 
** czfrmaseeptbaq-mycgwmctsa-n
 
* molecular-weight:
 
** 685.084
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14992]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=a [release factor]-n5-methyl-l-glutamine}}
{{#set: inchi-key=inchikey=czfrmaseeptbaq-mycgwmctsa-n}}
 
{{#set: molecular-weight=685.084}}
 

Revision as of 09:24, 27 August 2019

Metabolite Release-factor-N5-Methyl-L-glutamine

  • common-name:
    • a [release factor]-n5-methyl-l-glutamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [release factor]-n5-methyl-l-glutamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.