Difference between revisions of "SJ00422"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-GLUTAMYL-P N-ACETYL-GLUTAMYL-P] == * common-name: ** n-acetylglutamyl-phosphate * smil...")
 
(Created page with "Category:gene == Gene SJ00422 == * transcription-direction: ** negative * right-end-position: ** 158759 * left-end-position: ** 136792 * centisome-position: ** 81.72786...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-GLUTAMYL-P N-ACETYL-GLUTAMYL-P] ==
+
== Gene SJ00422 ==
* common-name:
+
* transcription-direction:
** n-acetylglutamyl-phosphate
+
** negative
* smiles:
+
* right-end-position:
** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-]
+
** 158759
* inchi-key:
+
* left-end-position:
** fcvihfvsxhopsw-yfkpbyrvsa-k
+
** 136792
* molecular-weight:
+
* centisome-position:
** 266.124
+
** 81.72786   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ACETYLGLUTKIN-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[N-ACETYLGLUTPREDUCT-RXN]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[2.7.1.68-RXN]]
* [[ACETYLGLUTKIN-RXN]]
+
** Category: [[annotation]]
* [[AGK]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[N-ACETYLGLUTPREDUCT-RXN]]
+
** Category: [[orthology]]
== Reaction(s) of unknown directionality ==
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
{{#set: common-name=n-acetylglutamyl-phosphate}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: inchi-key=inchikey=fcvihfvsxhopsw-yfkpbyrvsa-k}}
+
== Pathway(s) associated ==
{{#set: molecular-weight=266.124}}
+
* [[PWY-6352]]
 +
** '''5''' reactions found over '''8''' reactions in the full pathway
 +
* [[PWY-6351]]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=158759}}
 +
{{#set: left-end-position=136792}}
 +
{{#set: centisome-position=81.72786    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=2}}

Latest revision as of 11:01, 18 March 2021

Gene SJ00422

  • transcription-direction:
    • negative
  • right-end-position:
    • 158759
  • left-end-position:
    • 136792
  • centisome-position:
    • 81.72786

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6352
    • 5 reactions found over 8 reactions in the full pathway
  • PWY-6351
    • 4 reactions found over 5 reactions in the full pathway