Difference between revisions of "SJ00435"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-166 CPD-166] == * common-name: ** a dolichyl β-d-glucosyl phosphate == Reaction(s) kno...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * common-name: ** dethiobiotin * smiles: ** cc1(nc(=o)nc1cccccc(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == |
* common-name: | * common-name: | ||
| − | ** | + | ** dethiobiotin |
| + | * smiles: | ||
| + | ** cc1(nc(=o)nc1cccccc(=o)[o-]) | ||
| + | * inchi-key: | ||
| + | ** autolbmxddtrrt-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 213.256 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.8.1.6-RXN]] |
| − | + | * [[RXN-17472]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DETHIOBIOTIN-SYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dethiobiotin}} |
| + | {{#set: inchi-key=inchikey=autolbmxddtrrt-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=213.256}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite DETHIOBIOTIN
- common-name:
- dethiobiotin
- smiles:
- cc1(nc(=o)nc1cccccc(=o)[o-])
- inchi-key:
- autolbmxddtrrt-uhfffaoysa-m
- molecular-weight:
- 213.256
