Difference between revisions of "SJ00495"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] == * common-name: ** d-myo-inositol 1,3,4,5,6-pentakisphosphate * smiles: **...")
(Created page with "Category:gene == Gene SJ00495 == * transcription-direction: ** negative * right-end-position: ** 16242 * left-end-position: ** 31 * centisome-position: ** 5.459707400e-3 =...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] ==
+
== Gene SJ00495 ==
−
* common-name:
+
* transcription-direction:
−
** d-myo-inositol 1,3,4,5,6-pentakisphosphate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** 16242
−
* inchi-key:
+
* left-end-position:
−
** ctpqaxvnygzuaj-kxxvrosksa-d
+
** 31
−
* molecular-weight:
+
* centisome-position:
−
** 569.977
+
** 5.459707400e-3
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-10963]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN-13197]]
+
== Reaction(s) associated ==
−
* [[RXN-7163]]
+
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[2.7.1.134-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[2.7.1.140-RXN]]
+
{{#set: transcription-direction=negative}}
−
* [[RXN-10963]]
+
{{#set: right-end-position=16242}}
−
* [[RXN-13197]]
+
{{#set: left-end-position=31}}
−
* [[RXN-7162]]
+
{{#set: centisome-position=5.459707400e-3}}
−
* [[RXN-7184]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
−
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction associated=1}}
−
{{#set: common-name=d-myo-inositol 1,3,4,5,6-pentakisphosphate}}
 
−
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-kxxvrosksa-d}}
 
−
{{#set: molecular-weight=569.977}}
 

Latest revision as of 11:04, 18 March 2021

Gene SJ00495

  • transcription-direction:
    • negative
  • right-end-position:
    • 16242
  • left-end-position:
    • 31
  • centisome-position:
    • 5.459707400e-3

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ00495&oldid=133439"