Difference between revisions of "SJ00687"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-578 CPD-578] == * common-name: ** urea-1-carboxylate * smiles: ** c(n)(nc([o-])=o)=o * inch...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] == * common-name: ** 3-sulfinoalanine * smiles: ** c(c([n+])...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-sulfinoalanine |
* smiles: | * smiles: | ||
− | ** c(n)( | + | ** c(c([n+])c(=o)[o-])s([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** advptqaunprnpo-reohclbhsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 152.145 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] | ||
+ | * [[CYSTEINE-DIOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-sulfinoalanine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=advptqaunprnpo-reohclbhsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=152.145}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite 3-SULFINOALANINE
- common-name:
- 3-sulfinoalanine
- smiles:
- c(c([n+])c(=o)[o-])s([o-])=o
- inchi-key:
- advptqaunprnpo-reohclbhsa-m
- molecular-weight:
- 152.145