Difference between revisions of "SJ00798"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATE DIHYDROFOLATE] == * common-name: ** 7,8-dihydrofolate monoglutamate * smiles: **...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-arginyl-L-aspartyl-Peptides L-arginyl-L-aspartyl-Peptides] == * common-name: ** an n-terminal...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATE DIHYDROFOLATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-arginyl-L-aspartyl-Peptides L-arginyl-L-aspartyl-Peptides] ==
 
* common-name:
 
* common-name:
** 7,8-dihydrofolate monoglutamate
+
** an n-terminal l-arginiyl-l-aspartyl-[protein]
* smiles:
 
** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
 
* inchi-key:
 
** ozrnssudzolusn-lbprgkrzsa-l
 
* molecular-weight:
 
** 441.402
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DHFR2i]]
 
* [[DHFRi]]
 
* [[MDUMT]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DHFOR]]
+
* [[RXN-17889]]
* [[DIHYDROFOLATESYNTH-RXN]]
 
* [[FOLR2]]
 
* [[MDUMT]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydrofolate monoglutamate}}
+
{{#set: common-name=an n-terminal l-arginiyl-l-aspartyl-[protein]}}
{{#set: inchi-key=inchikey=ozrnssudzolusn-lbprgkrzsa-l}}
 
{{#set: molecular-weight=441.402}}
 

Revision as of 09:23, 27 August 2019

Metabolite L-arginyl-L-aspartyl-Peptides

  • common-name:
    • an n-terminal l-arginiyl-l-aspartyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal l-arginiyl-l-aspartyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.