Difference between revisions of "SJ00803"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * common-name: ** 3-phospho-l-serine * smiles: ** c(op([o-])([o-])=o)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TRYPTOPHAN D-TRYPTOPHAN] == * common-name: ** d-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TRYPTOPHAN D-TRYPTOPHAN] == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-tryptophan |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qivbcdijiajpqs-secbinfhsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 204.228 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8664]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-tryptophan}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qivbcdijiajpqs-secbinfhsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=204.228}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite D-TRYPTOPHAN
- common-name:
- d-tryptophan
- smiles:
- c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
- inchi-key:
- qivbcdijiajpqs-secbinfhsa-n
- molecular-weight:
- 204.228
