Difference between revisions of "SJ00803"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TRYPTOPHAN D-TRYPTOPHAN] == * common-name: ** d-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine37-in-tRNA Guanine37-in-tRNA] == * common-name: ** a guanine37 in trna == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TRYPTOPHAN D-TRYPTOPHAN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine37-in-tRNA Guanine37-in-tRNA] ==
 
* common-name:
 
* common-name:
** d-tryptophan
+
** a guanine37 in trna
* smiles:
 
** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
 
* inchi-key:
 
** qivbcdijiajpqs-secbinfhsa-n
 
* molecular-weight:
 
** 204.228
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8664]]
+
* [[RXN-12458]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-tryptophan}}
+
{{#set: common-name=a guanine37 in trna}}
{{#set: inchi-key=inchikey=qivbcdijiajpqs-secbinfhsa-n}}
 
{{#set: molecular-weight=204.228}}
 

Revision as of 09:24, 27 August 2019

Metabolite Guanine37-in-tRNA

  • common-name:
    • a guanine37 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality