Difference between revisions of "SJ00814"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17621 CPD-17621] == * common-name: ** 16-hydroxypalmitoyl-coa * smiles: ** cc(c)(c(o)c(=o)n...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEUKOTRIENE-C4 LEUKOTRIENE-C4] == * common-name: ** leukotriene-c4 * smiles: ** cccccc=ccc=cc=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17621 CPD-17621] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEUKOTRIENE-C4 LEUKOTRIENE-C4] ==
 
* common-name:
 
* common-name:
** 16-hydroxypalmitoyl-coa
+
** leukotriene-c4
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccccccccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** rozgnndroqhxpf-bbecnahfsa-j
+
** gwnvdxqdilpjig-nxolixfesa-l
 
* molecular-weight:
 
* molecular-weight:
** 1017.914
+
** 623.76
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-336]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16389]]
+
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=16-hydroxypalmitoyl-coa}}
+
{{#set: common-name=leukotriene-c4}}
{{#set: inchi-key=inchikey=rozgnndroqhxpf-bbecnahfsa-j}}
+
{{#set: inchi-key=inchikey=gwnvdxqdilpjig-nxolixfesa-l}}
{{#set: molecular-weight=1017.914}}
+
{{#set: molecular-weight=623.76}}

Revision as of 14:20, 26 August 2019

Metabolite LEUKOTRIENE-C4

  • common-name:
    • leukotriene-c4
  • smiles:
    • cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc([o-])=o)o
  • inchi-key:
    • gwnvdxqdilpjig-nxolixfesa-l
  • molecular-weight:
    • 623.76

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality