Difference between revisions of "SJ00842"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-Chain-234-Saturated-acyl-CoAs Short-Chain-234-Saturated-acyl-CoAs] == * common-name: ** a...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15688 CPD-15688] == * common-name: ** (3z,5e)-dodeca-3,5-dienoyl-coa * smiles: ** ccccccc=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-Chain-234-Saturated-acyl-CoAs Short-Chain-234-Saturated-acyl-CoAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15688 CPD-15688] ==
 
* common-name:
 
* common-name:
** a short-chain 2,3,4-saturated fatty acyl coa
+
** (3z,5e)-dodeca-3,5-dienoyl-coa
 +
* smiles:
 +
** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** arquzfjqpywssl-nbluimthsa-j
 +
* molecular-weight:
 +
** 941.776
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13449]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14799]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a short-chain 2,3,4-saturated fatty acyl coa}}
+
{{#set: common-name=(3z,5e)-dodeca-3,5-dienoyl-coa}}
 +
{{#set: inchi-key=inchikey=arquzfjqpywssl-nbluimthsa-j}}
 +
{{#set: molecular-weight=941.776}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-15688

  • common-name:
    • (3z,5e)-dodeca-3,5-dienoyl-coa
  • smiles:
    • ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • arquzfjqpywssl-nbluimthsa-j
  • molecular-weight:
    • 941.776

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality