Difference between revisions of "SJ00842"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15688 CPD-15688] == * common-name: ** (3z,5e)-dodeca-3,5-dienoyl-coa * smiles: ** ccccccc=c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYLAMINE DIMETHYLAMINE] == * common-name: ** dimethylamine * smiles: ** c[n+]c * inchi-key...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15688 CPD-15688] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYLAMINE DIMETHYLAMINE] ==
 
* common-name:
 
* common-name:
** (3z,5e)-dodeca-3,5-dienoyl-coa
+
** dimethylamine
 
* smiles:
 
* smiles:
** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c[n+]c
 
* inchi-key:
 
* inchi-key:
** arquzfjqpywssl-nbluimthsa-j
+
** rosdsfdqcjngol-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 941.776
+
** 46.092
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14799]]
+
* [[DIMETHYLARGININASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3z,5e)-dodeca-3,5-dienoyl-coa}}
+
{{#set: common-name=dimethylamine}}
{{#set: inchi-key=inchikey=arquzfjqpywssl-nbluimthsa-j}}
+
{{#set: inchi-key=inchikey=rosdsfdqcjngol-uhfffaoysa-o}}
{{#set: molecular-weight=941.776}}
+
{{#set: molecular-weight=46.092}}

Revision as of 09:23, 27 August 2019

Metabolite DIMETHYLAMINE

  • common-name:
    • dimethylamine
  • smiles:
    • c[n+]c
  • inchi-key:
    • rosdsfdqcjngol-uhfffaoysa-o
  • molecular-weight:
    • 46.092

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality