Difference between revisions of "SJ00850"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == * common-name: ** 3-[(7'-methylthio)heptyl]malate * smiles: ** cscccccccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phytoceramides Phytoceramides] == * common-name: ** a phytoceramide == Reaction(s) known to con...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phytoceramides Phytoceramides] ==
 
* common-name:
 
* common-name:
** 3-[(7'-methylthio)heptyl]malate
+
** a phytoceramide
* smiles:
 
** cscccccccc(c(o)c(=o)[o-])c(=o)[o-]
 
* inchi-key:
 
** sxljfgxgvbwoob-uhfffaoysa-l
 
* molecular-weight:
 
** 276.347
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18200]]
 
* [[RXNQT-4178]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18200]]
+
* [[RXN3O-328]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-[(7'-methylthio)heptyl]malate}}
+
{{#set: common-name=a phytoceramide}}
{{#set: inchi-key=inchikey=sxljfgxgvbwoob-uhfffaoysa-l}}
 
{{#set: molecular-weight=276.347}}
 

Revision as of 14:20, 26 August 2019

Metabolite Phytoceramides

  • common-name:
    • a phytoceramide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality