Difference between revisions of "SJ00855"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-511 CPD-511] == * common-name: ** pantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)co *...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * common-name: ** campest-4-en-3-one * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-511 CPD-511] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] ==
 
* common-name:
 
* common-name:
** pantetheine
+
** campest-4-en-3-one
 
* smiles:
 
* smiles:
** cc(c(o)c(=o)nccc(nccs)=o)(c)co
+
** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** znxzgrmvnnhpca-vifpvbqesa-n
+
** qqiopzfvtihasb-imudckkosa-n
 
* molecular-weight:
 
* molecular-weight:
** 278.366
+
** 398.671
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PANTETHEINE-KINASE-RXN]]
+
* [[RXN-4231]]
 +
* [[RXN-711]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PANTETHEINE-KINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pantetheine}}
+
{{#set: common-name=campest-4-en-3-one}}
{{#set: inchi-key=inchikey=znxzgrmvnnhpca-vifpvbqesa-n}}
+
{{#set: inchi-key=inchikey=qqiopzfvtihasb-imudckkosa-n}}
{{#set: molecular-weight=278.366}}
+
{{#set: molecular-weight=398.671}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-698

  • common-name:
    • campest-4-en-3-one
  • smiles:
    • cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • qqiopzfvtihasb-imudckkosa-n
  • molecular-weight:
    • 398.671

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality