Difference between revisions of "SJ00876"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] == * common-name: ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hydroxy-carboxylates 2-Hydroxy-carboxylates] == * common-name: ** a 2-hydroxy carboxylate ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hydroxy-carboxylates 2-Hydroxy-carboxylates] ==
 
* common-name:
 
* common-name:
** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
+
** a 2-hydroxy carboxylate
* smiles:
 
** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
 
* inchi-key:
 
** gfjkjlhwwzxdau-kxfgnqbasa-l
 
* molecular-weight:
 
** 450.508
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16118]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16117]]
+
* [[RXN-7919]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-[18-hydroxyoleyl]-2-lyso-phosphatidate}}
+
{{#set: common-name=a 2-hydroxy carboxylate}}
{{#set: inchi-key=inchikey=gfjkjlhwwzxdau-kxfgnqbasa-l}}
 
{{#set: molecular-weight=450.508}}
 

Revision as of 14:19, 26 August 2019

Metabolite 2-Hydroxy-carboxylates

  • common-name:
    • a 2-hydroxy carboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality