Difference between revisions of "SJ00878"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Nonmethylated-Ribosomal-Protein-L11s Nonmethylated-Ribosomal-Protein-L11s] == * common-name: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] == * common-name: ** sinapoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] == |
* common-name: | * common-name: | ||
− | ** | + | ** sinapoyl-coa |
+ | * smiles: | ||
+ | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** rbfuwesmwrugfy-gsnioflcsa-j | ||
+ | * molecular-weight: | ||
+ | ** 969.7 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-1124]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10919]] | ||
+ | * [[RXN-1124]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=sinapoyl-coa}} |
+ | {{#set: inchi-key=inchikey=rbfuwesmwrugfy-gsnioflcsa-j}} | ||
+ | {{#set: molecular-weight=969.7}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite SINAPOYL-COA
- common-name:
- sinapoyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi-key:
- rbfuwesmwrugfy-gsnioflcsa-j
- molecular-weight:
- 969.7