Difference between revisions of "SJ00894"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9925 CPD-9925] == * common-name: ** 1,4-dihydroxy-2-naphthoyl-coa * smiles: ** cc(c)(c(o)c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE GUANOSINE] == * common-name: ** guanosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9925 CPD-9925] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE GUANOSINE] ==
 
* common-name:
 
* common-name:
** 1,4-dihydroxy-2-naphthoyl-coa
+
** guanosine
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c2(c=c(o)c1(=cc=cc=c1c(o)=2)))=o)cop(=o)(op(=o)(occ3(c(op([o-])(=o)[o-])c(o)c(o3)n5(c4(=c(c(n)=nc=n4)n=c5))))[o-])[o-]
+
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
* inchi-key:
** pytinlgpkdjurz-hsjnekgzsa-j
+
** nyhbqmygnkiuif-uuokfmhzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 949.669
+
** 283.243
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-366]]
 +
* [[RXN0-5199]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NAPHTHOATE-SYN-RXN]]
+
* [[RXN-7609]]
 +
* [[RXN0-5199]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,4-dihydroxy-2-naphthoyl-coa}}
+
{{#set: common-name=guanosine}}
{{#set: inchi-key=inchikey=pytinlgpkdjurz-hsjnekgzsa-j}}
+
{{#set: inchi-key=inchikey=nyhbqmygnkiuif-uuokfmhzsa-n}}
{{#set: molecular-weight=949.669}}
+
{{#set: molecular-weight=283.243}}

Revision as of 09:23, 27 August 2019

Metabolite GUANOSINE

  • common-name:
    • guanosine
  • smiles:
    • c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • nyhbqmygnkiuif-uuokfmhzsa-n
  • molecular-weight:
    • 283.243

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality