Difference between revisions of "SJ00931"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] == * common-name: ** n-formyl-d-kynurenine * smiles: ** c(=o)nc1(c(c(=o)cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13080 CPD-13080] == * common-name: ** solasodine * smiles: ** cc1(cnc2(cc1)(c(c)c3([ch](o2)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13080 CPD-13080] ==
 
* common-name:
 
* common-name:
** n-formyl-d-kynurenine
+
** solasodine
 
* smiles:
 
* smiles:
** c(=o)nc1(c(c(=o)cc([n+])c(=o)[o-])=cc=cc=1)
+
** cc1(cnc2(cc1)(c(c)c3([ch](o2)cc4(c(c)3cc[ch]5([ch]4cc=c6(c(c)5ccc(o)c6))))))
 
* inchi-key:
 
* inchi-key:
** byhjhxptqmmkca-uhfffaoysa-n
+
** kwvisvamqjwjsz-rqommasjsa-n
 
* molecular-weight:
 
* molecular-weight:
** 236.227
+
** 413.642
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12123]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8664]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-formyl-d-kynurenine}}
+
{{#set: common-name=solasodine}}
{{#set: inchi-key=inchikey=byhjhxptqmmkca-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=kwvisvamqjwjsz-rqommasjsa-n}}
{{#set: molecular-weight=236.227}}
+
{{#set: molecular-weight=413.642}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-13080

  • common-name:
    • solasodine
  • smiles:
    • cc1(cnc2(cc1)(c(c)c3([ch](o2)cc4(c(c)3cc[ch]5([ch]4cc=c6(c(c)5ccc(o)c6))))))
  • inchi-key:
    • kwvisvamqjwjsz-rqommasjsa-n
  • molecular-weight:
    • 413.642

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality