Difference between revisions of "SJ01052"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETOACETYL-COA ACETOACETYL-COA] == * common-name: ** acetoacetyl-coa * smiles: ** cc(=o)cc(=o)...")
(Created page with "Category:gene == Gene SJ03844 == * transcription-direction: ** negative * right-end-position: ** 10661 * left-end-position: ** 8721 * centisome-position: ** 7.5623693...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETOACETYL-COA ACETOACETYL-COA] ==
+
== Gene SJ03844 ==
−
* common-name:
+
* transcription-direction:
−
** acetoacetyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 10661
−
* inchi-key:
+
* left-end-position:
−
** ojfdkhtzouzbos-citakdkdsa-j
+
** 8721
−
* molecular-weight:
+
* centisome-position:
−
** 847.577
+
** 7.5623693   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]]
+
* [[S.japonica_sterols_curated]]
−
* [[ACACT1h]]
+
== Reaction(s) associated ==
−
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
* [[HACD1h]]
+
** Category: [[annotation]]
−
* [[HBCO_LPAREN_nadp_RPAREN_]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[HBCO_LPAREN_nadp_RPAREN_m]]
+
{{#set: transcription-direction=negative}}
−
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
+
{{#set: right-end-position=10661}}
−
* [[RXN-11662]]
+
{{#set: left-end-position=8721}}
−
* [[RXN-5901]]
+
{{#set: centisome-position=7.5623693    }}
−
== Reaction(s) known to produce the compound ==
+
{{#set: organism associated=S.japonica_sterols_curated}}
−
* [[ACACT]]
+
{{#set: nb reaction associated=1}}
−
* [[ACACT1h]]
 
−
* [[ACETOACETATE--COA-LIGASE-RXN]]
 
−
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 
−
* [[HACD1h]]
 
−
* [[HBCO]]
 
−
* [[HBCO_LPAREN_nadp_RPAREN_]]
 
−
* [[HBCO_LPAREN_nadp_RPAREN_m]]
 
−
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 
−
* [[RXN-11662]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=acetoacetyl-coa}}
 
−
{{#set: inchi-key=inchikey=ojfdkhtzouzbos-citakdkdsa-j}}
 
−
{{#set: molecular-weight=847.577}}
 

Revision as of 20:19, 18 December 2020

Gene SJ03844

  • transcription-direction:
    • negative
  • right-end-position:
    • 10661
  • left-end-position:
    • 8721
  • centisome-position:
    • 7.5623693

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ01052&oldid=40683"