Difference between revisions of "SJ01094"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N1-METHYLADENINE N1-METHYLADENINE] == * common-name: ** n1-methyladenine * smiles: ** cn2(c=nc1...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15237 CPD-15237] == * common-name: ** glucosyl-(heptosyl)3-glucosyluronate-kdo2-lipid a-pho...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N1-METHYLADENINE N1-METHYLADENINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15237 CPD-15237] ==
 
* common-name:
 
* common-name:
** n1-methyladenine
+
** glucosyl-(heptosyl)3-glucosyluronate-kdo2-lipid a-phosphate
* smiles:
 
** cn2(c=nc1(c(n=cn=1)=c(n)2))
 
* inchi-key:
 
** hpzmwtnatzpbih-uhfffaoysa-n
 
* molecular-weight:
 
** 149.155
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-984]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14361]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n1-methyladenine}}
+
{{#set: common-name=glucosyl-(heptosyl)3-glucosyluronate-kdo2-lipid a-phosphate}}
{{#set: inchi-key=inchikey=hpzmwtnatzpbih-uhfffaoysa-n}}
 
{{#set: molecular-weight=149.155}}
 

Revision as of 09:24, 27 August 2019

Metabolite CPD-15237

  • common-name:
    • glucosyl-(heptosyl)3-glucosyluronate-kdo2-lipid a-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality