Difference between revisions of "SJ01225"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=pppGp-his-tRNAs pppGp-his-tRNAs] == * common-name: ** 5'-triphospho-guanosine-ribonucleotide-[t...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-SEROTONIN N-ACETYL-SEROTONIN] == * common-name: ** n-acetyl-serotonin * smiles: ** cc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-SEROTONIN N-ACETYL-SEROTONIN] == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-serotonin |
| + | * smiles: | ||
| + | ** cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2)) | ||
| + | * inchi-key: | ||
| + | ** mvawjsidnickhf-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 218.255 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11059]] | ||
| + | * [[RXN-11060]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11057]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-serotonin}} |
| + | {{#set: inchi-key=inchikey=mvawjsidnickhf-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=218.255}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite N-ACETYL-SEROTONIN
- common-name:
- n-acetyl-serotonin
- smiles:
- cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2))
- inchi-key:
- mvawjsidnickhf-uhfffaoysa-n
- molecular-weight:
- 218.255
