Difference between revisions of "SJ01274"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP GDP] == * common-name: ** gdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n...")
 
(Created page with "Category:gene == Gene SJ01274 == * transcription-direction: ** negative * right-end-position: ** 21628 * left-end-position: ** 20140 * centisome-position: ** 13.145098...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP GDP] ==
+
== Gene SJ01274 ==
−
* common-name:
+
* transcription-direction:
−
** gdp
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** 21628
−
* inchi-key:
+
* left-end-position:
−
** qgwndrxfnxrzmb-uuokfmhzsa-k
+
** 20140
−
* molecular-weight:
+
* centisome-position:
−
** 440.179
+
** 13.145098   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[2.4.1.221-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[ATGD]]
+
== Reaction(s) associated ==
−
* [[DGOTO]]
+
* [[PEROXID-RXN]]
−
* [[GBDP]]
+
** Category: [[annotation]]
−
* [[GDPKIN-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[GDPPYPHOSKIN-RXN]]
+
* [[RXN-14240]]
−
* [[GDPREDUCT-RXN]]
+
** Category: [[annotation]]
−
* [[GTPOP]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[GUANOSINE-DIPHOSPHATASE-RXN]]
+
* [[RXN-15288]]
−
* [[MANNPGUANYLTRANGDP-RXN]]
+
** Category: [[annotation]]
−
* [[RXN-12486]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-14117]]
+
* [[RXN-17352]]
−
* [[RXN-15268]]
+
** Category: [[annotation]]
−
* [[RXN0-748]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
+
* [[RXN-8635]]
−
* [[SUCL_LPAREN_gdp_RPAREN_m]]
+
** Category: [[annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Pathway(s) associated ==
−
* [[2.4.1.142-RXN]]
+
* [[PWY-7214]]
−
* [[2.4.1.221-RXN]]
+
** '''1''' reactions found over '''2''' reactions in the full pathway
−
* [[2.4.1.68-RXN]]
+
* [[PWY-7445]]
−
* [[2.4.1.83-RXN]]
+
** '''1''' reactions found over '''4''' reactions in the full pathway
−
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+
* [[PWY-5466]]
−
* [[AGPT]]
+
** '''2''' reactions found over '''10''' reactions in the full pathway
−
* [[ALGINATE-SYNTHASE-RXN]]
+
* [[PWY-6824]]
−
* [[FE2GTPabc]]
+
** '''2''' reactions found over '''10''' reactions in the full pathway
−
* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
+
* [[PWY-5469]]
−
* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]]
+
** '''2''' reactions found over '''8''' reactions in the full pathway
−
* [[GBDP]]
+
* [[PWY-5461]]
−
* [[GTCY]]
+
** '''1''' reactions found over '''1''' reactions in the full pathway
−
* [[GTUP]]
+
{{#set: transcription-direction=negative}}
−
* [[GUANYL-KIN-RXN]]
+
{{#set: right-end-position=21628}}
−
* [[MANNPGUANYLTRANGDP-RXN]]
+
{{#set: left-end-position=20140}}
−
* [[PPGPPSYN-RXN]]
+
{{#set: centisome-position=13.145098    }}
−
* [[RXN-12486]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
−
* [[RXN-15268]]
+
{{#set: nb reaction associated=5}}
−
* [[RXN-16602]]
+
{{#set: nb pathway associated=6}}
−
* [[RXN-5462]]
 
−
* [[RXN-5463]]
 
−
* [[RXN-5464]]
 
−
* [[RXN-8988]]
 
−
* [[RXN-9463]]
 
−
* [[RXN0-5462]]
 
−
* [[RXNQT-4141]]
 
−
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
−
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
−
* [[URKI-RXN]]
 
−
</div>
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=gdp}}
 
−
{{#set: inchi-key=inchikey=qgwndrxfnxrzmb-uuokfmhzsa-k}}
 
−
{{#set: molecular-weight=440.179}}
 

Latest revision as of 11:04, 18 March 2021

Gene SJ01274

  • transcription-direction:
    • negative
  • right-end-position:
    • 21628
  • left-end-position:
    • 20140
  • centisome-position:
    • 13.145098

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7214
    • 1 reactions found over 2 reactions in the full pathway
  • PWY-7445
    • 1 reactions found over 4 reactions in the full pathway
  • PWY-5466
    • 2 reactions found over 10 reactions in the full pathway
  • PWY-6824
    • 2 reactions found over 10 reactions in the full pathway
  • PWY-5469
    • 2 reactions found over 8 reactions in the full pathway
  • PWY-5461
    • 1 reactions found over 1 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ01274&oldid=133252"