Difference between revisions of "SJ01328"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-171 CPD-171] == * common-name: ** a dolichyl β-d-mannosyl phosphate == Reaction(s) kno...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] == * common-name: ** maltoheptaose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] == |
* common-name: | * common-name: | ||
− | ** | + | ** maltoheptaose |
+ | * smiles: | ||
+ | ** c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o)c(oc6(c(o)c(o)c(oc4(c(o)c(o)c(oc(co)4)oc5(c(o)c(o)c(o)oc(co)5)))oc(co)6))oc(co)7)))) | ||
+ | * inchi-key: | ||
+ | ** bnabbhgyymzmoa-qjbbzcpbsa-n | ||
+ | * molecular-weight: | ||
+ | ** 1153.009 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-14283]] | |
− | + | * [[RXN-14286]] | |
− | |||
− | * [[RXN- | ||
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=maltoheptaose}} |
+ | {{#set: inchi-key=inchikey=bnabbhgyymzmoa-qjbbzcpbsa-n}} | ||
+ | {{#set: molecular-weight=1153.009}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD0-1133
- common-name:
- maltoheptaose
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o)c(oc6(c(o)c(o)c(oc4(c(o)c(o)c(oc(co)4)oc5(c(o)c(o)c(o)oc(co)5)))oc(co)6))oc(co)7))))
- inchi-key:
- bnabbhgyymzmoa-qjbbzcpbsa-n
- molecular-weight:
- 1153.009