Difference between revisions of "SJ01332"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14893 CPD-14893] == * common-name: ** ergost-7-enol * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXYBENZOATE 3-HEXAPRENYL-4-HYDROXYBENZOATE] == * common-name: ** 3-hexapreny...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14893 CPD-14893] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXYBENZOATE 3-HEXAPRENYL-4-HYDROXYBENZOATE] ==
 
* common-name:
 
* common-name:
** ergost-7-enol
+
** 3-hexaprenyl-4-hydroxybenzoate
 
* smiles:
 
* smiles:
** cc(c)c(c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** pugbzuwutzuucp-zrkhgvcbsa-n
+
** lkmqqqabigihgl-laaqxviisa-m
 
* molecular-weight:
 
* molecular-weight:
** 400.687
+
** 545.824
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13883]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9003]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ergost-7-enol}}
+
{{#set: common-name=3-hexaprenyl-4-hydroxybenzoate}}
{{#set: inchi-key=inchikey=pugbzuwutzuucp-zrkhgvcbsa-n}}
+
{{#set: inchi-key=inchikey=lkmqqqabigihgl-laaqxviisa-m}}
{{#set: molecular-weight=400.687}}
+
{{#set: molecular-weight=545.824}}

Revision as of 14:20, 26 August 2019

Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE

  • common-name:
    • 3-hexaprenyl-4-hydroxybenzoate
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c
  • inchi-key:
    • lkmqqqabigihgl-laaqxviisa-m
  • molecular-weight:
    • 545.824

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality