Difference between revisions of "SJ01332"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXYBENZOATE 3-HEXAPRENYL-4-HYDROXYBENZOATE] == * common-name: ** 3-hexapreny...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-Acetyl-Lysine Histone-Acetyl-Lysine] == * common-name: ** a [histone]-n6-acetyl-l-lysin...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXYBENZOATE 3-HEXAPRENYL-4-HYDROXYBENZOATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-Acetyl-Lysine Histone-Acetyl-Lysine] ==
 
* common-name:
 
* common-name:
** 3-hexaprenyl-4-hydroxybenzoate
+
** a [histone]-n6-acetyl-l-lysine
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c
 
* inchi-key:
 
** lkmqqqabigihgl-laaqxviisa-m
 
* molecular-weight:
 
** 545.824
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.5.1.98-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9003]]
+
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hexaprenyl-4-hydroxybenzoate}}
+
{{#set: common-name=a [histone]-n6-acetyl-l-lysine}}
{{#set: inchi-key=inchikey=lkmqqqabigihgl-laaqxviisa-m}}
 
{{#set: molecular-weight=545.824}}
 

Revision as of 09:24, 27 August 2019

Metabolite Histone-Acetyl-Lysine

  • common-name:
    • a [histone]-n6-acetyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [histone]-n6-acetyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.