Difference between revisions of "SJ01397"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLYCYL-PEPTIDE == * smiles: ** c(c(nc(c(o)=o)[r])=o)n * common-name: ** glycyl-peptide == Reaction(s) known to consume the compound == *...") |
(Created page with "Category:metabolite == Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6 == * common-name: ** (5s)-hpete * smiles: ** cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o * inchi-key: ** jnuun...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6 == |
| + | * common-name: | ||
| + | ** (5s)-hpete | ||
* smiles: | * smiles: | ||
| − | ** | + | ** cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** jnuunuqhxiofda-jgklhwiesa-m |
| + | * molecular-weight: | ||
| + | ** 335.462 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8647]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ARACHIDONATE-5-LIPOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(5s)-hpete}} |
| + | {{#set: inchi-key=inchikey=jnuunuqhxiofda-jgklhwiesa-m}} | ||
| + | {{#set: molecular-weight=335.462}} | ||
Revision as of 15:24, 5 January 2021
Contents
Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6
- common-name:
- (5s)-hpete
- smiles:
- cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o
- inchi-key:
- jnuunuqhxiofda-jgklhwiesa-m
- molecular-weight:
- 335.462
