Difference between revisions of "SJ01458"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == * common-name: ** 18-hydroxyoleate * smiles: ** c(o)ccccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ERGOSTEROL ERGOSTEROL] == * common-name: ** ergosterol * smiles: ** cc(c)c(c)c=cc(c)[ch]3(cc[ch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ERGOSTEROL ERGOSTEROL] ==
 
* common-name:
 
* common-name:
** 18-hydroxyoleate
+
** ergosterol
 
* smiles:
 
* smiles:
** c(o)cccccccc=ccccccccc(=o)[o-]
+
** cc(c)c(c)c=cc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** lquhzvlttwmbto-uphrsurjsa-m
+
** dnvpqkqsnymlrs-apgdwvjjsa-n
 
* molecular-weight:
 
* molecular-weight:
** 297.457
+
** 396.655
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16402]]
+
* [[RXN-16975]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15135]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=18-hydroxyoleate}}
+
{{#set: common-name=ergosterol}}
{{#set: inchi-key=inchikey=lquhzvlttwmbto-uphrsurjsa-m}}
+
{{#set: inchi-key=inchikey=dnvpqkqsnymlrs-apgdwvjjsa-n}}
{{#set: molecular-weight=297.457}}
+
{{#set: molecular-weight=396.655}}

Revision as of 14:19, 26 August 2019

Metabolite ERGOSTEROL

  • common-name:
    • ergosterol
  • smiles:
    • cc(c)c(c)c=cc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • dnvpqkqsnymlrs-apgdwvjjsa-n
  • molecular-weight:
    • 396.655

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality