Difference between revisions of "SJ01518"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * common-name: ** α,ω...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] == * common-name: ** l-thyroxine phenolic β-d-glucuronide * smiles: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] == |
* common-name: | * common-name: | ||
| − | ** & | + | ** l-thyroxine phenolic β-d-glucuronide |
* smiles: | * smiles: | ||
| − | ** c(=o)([o-]) | + | ** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rghrjbikiyuhev-sgpdefqssa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 951.992 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10606]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=& | + | {{#set: common-name=l-thyroxine phenolic β-d-glucuronide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rghrjbikiyuhev-sgpdefqssa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=951.992}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-11398
- common-name:
- l-thyroxine phenolic β-d-glucuronide
- smiles:
- c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
- inchi-key:
- rghrjbikiyuhev-sgpdefqssa-m
- molecular-weight:
- 951.992
