Difference between revisions of "SJ01580"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acetyl-beta-D-Hexosaminides N-Acetyl-beta-D-Hexosaminides] == * common-name: ** an n-acetyl-&...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9897 CPD-9897] == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate * sm...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9897 CPD-9897] == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate |
+ | * smiles: | ||
+ | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c)c)c | ||
+ | * inchi-key: | ||
+ | ** wcqcnoikxgndlx-rdsvhmiisa-m | ||
+ | * molecular-weight: | ||
+ | ** 848.323 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-9282]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate}} |
+ | {{#set: inchi-key=inchikey=wcqcnoikxgndlx-rdsvhmiisa-m}} | ||
+ | {{#set: molecular-weight=848.323}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-9897
- common-name:
- 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c)c)c
- inchi-key:
- wcqcnoikxgndlx-rdsvhmiisa-m
- molecular-weight:
- 848.323