Difference between revisions of "SJ01673"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-20693 CPD-20693] == * common-name: ** diatoxanthin * smiles: ** cc(=cc=cc=c(c)c=cc=c(c#cc1(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] == * common-name: ** linoleoyl-coa * smiles: ** cccccc=ccc=ccccccccc(=o)sccnc(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-20693 CPD-20693] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] ==
 
* common-name:
 
* common-name:
** diatoxanthin
+
** linoleoyl-coa
 
* smiles:
 
* smiles:
** cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(c)=2)
+
** cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** hnyjhqmusvnwpv-drcjtwaysa-n
+
** yecllimzhnyfck-rrnjgntnsa-j
 
* molecular-weight:
 
* molecular-weight:
** 566.865
+
** 1025.937
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-19202]]
+
* [[1.14.19.3-RXN]]
 +
* [[FACOAE182]]
 +
* [[LINOLEOYL-RXN]]
 +
* [[RXN-16094]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-19200]]
+
* [[LNLCCOAL]]
 +
* [[RXN-16045]]
 +
* [[RXN-9601]]
 +
* [[RXN-9673]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=diatoxanthin}}
+
{{#set: common-name=linoleoyl-coa}}
{{#set: inchi-key=inchikey=hnyjhqmusvnwpv-drcjtwaysa-n}}
+
{{#set: inchi-key=inchikey=yecllimzhnyfck-rrnjgntnsa-j}}
{{#set: molecular-weight=566.865}}
+
{{#set: molecular-weight=1025.937}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-18

  • common-name:
    • linoleoyl-coa
  • smiles:
    • cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • yecllimzhnyfck-rrnjgntnsa-j
  • molecular-weight:
    • 1025.937

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality