Difference between revisions of "SJ01689"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] == * common-name: ** α-d-xylose 1-phosphate * smiles: ** c1(c(c(c(co1)o)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8076 CPD-8076] == * common-name: ** 1-18:3-2-16:1-monogalactosyldiacylglycerol * smiles: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8076 CPD-8076] == |
* common-name: | * common-name: | ||
− | ** | + | ** 1-18:3-2-16:1-monogalactosyldiacylglycerol |
* smiles: | * smiles: | ||
− | ** | + | ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** syspljxkzrpipm-lwnbrhqxsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 751.052 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-8297]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1-18:3-2-16:1-monogalactosyldiacylglycerol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=syspljxkzrpipm-lwnbrhqxsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=751.052}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-8076
- common-name:
- 1-18:3-2-16:1-monogalactosyldiacylglycerol
- smiles:
- ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
- inchi-key:
- syspljxkzrpipm-lwnbrhqxsa-n
- molecular-weight:
- 751.052