Difference between revisions of "SJ01769"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Dimethylgua-26-Gua27 tRNA-Containing-N2-Dimethylgua-26-Gua27] == * common-na...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == * common-name: ** tetraiodothyroacetate ether glucuronide * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == |
* common-name: | * common-name: | ||
| − | ** | + | ** tetraiodothyroacetate ether glucuronide |
| + | * smiles: | ||
| + | ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3)) | ||
| + | * inchi-key: | ||
| + | ** gyorpzqlvmnogy-rupwjetcsa-l | ||
| + | * molecular-weight: | ||
| + | ** 921.943 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10616]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tetraiodothyroacetate ether glucuronide}} |
| + | {{#set: inchi-key=inchikey=gyorpzqlvmnogy-rupwjetcsa-l}} | ||
| + | {{#set: molecular-weight=921.943}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-11409
- common-name:
- tetraiodothyroacetate ether glucuronide
- smiles:
- c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3))
- inchi-key:
- gyorpzqlvmnogy-rupwjetcsa-l
- molecular-weight:
- 921.943
