Difference between revisions of "SJ01769"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15836 CPD-15836] == * common-name: ** α-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Dimethylgua-26-Gua27 tRNA-Containing-N2-Dimethylgua-26-Gua27] == * common-na...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15836 CPD-15836] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Dimethylgua-26-Gua27 tRNA-Containing-N2-Dimethylgua-26-Gua27] ==
 
* common-name:
 
* common-name:
** α-tocotrienol
+
** an n2 dimethylguanine26/guanine27 in trna
* smiles:
 
** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c
 
* inchi-key:
 
** rzfhlolgzpdchj-xzxlulotsa-n
 
* molecular-weight:
 
** 424.665
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12380]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14918]]
+
* [[RXN-12379]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-tocotrienol}}
+
{{#set: common-name=an n2 dimethylguanine26/guanine27 in trna}}
{{#set: inchi-key=inchikey=rzfhlolgzpdchj-xzxlulotsa-n}}
 
{{#set: molecular-weight=424.665}}
 

Revision as of 14:20, 26 August 2019

Metabolite tRNA-Containing-N2-Dimethylgua-26-Gua27

  • common-name:
    • an n2 dimethylguanine26/guanine27 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality