Difference between revisions of "SJ01883"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * common-name: ** 2'-hydroxynicotine * smiles: ** c1(ccc(o)([n+](c)1)c2(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-N2methylguanine1516 16S-rRNA-N2methylguanine1516] == * common-name: ** an n2-methylgua...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-N2methylguanine1516 16S-rRNA-N2methylguanine1516] ==
 
* common-name:
 
* common-name:
** 2'-hydroxynicotine
+
** an n2-methylguanine1516 in 16s rrna
* smiles:
 
** c1(ccc(o)([n+](c)1)c2(=cn=cc=c2))
 
* inchi-key:
 
** boqrppfuushfgw-snvbaglbsa-o
 
* molecular-weight:
 
** 179.241
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-146]]
+
* [[RXN0-6731]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2'-hydroxynicotine}}
+
{{#set: common-name=an n2-methylguanine1516 in 16s rrna}}
{{#set: inchi-key=inchikey=boqrppfuushfgw-snvbaglbsa-o}}
 
{{#set: molecular-weight=179.241}}
 

Revision as of 14:19, 26 August 2019

Metabolite 16S-rRNA-N2methylguanine1516

  • common-name:
    • an n2-methylguanine1516 in 16s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality