Difference between revisions of "SJ01888"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1812 CPD0-1812] == * common-name: ** 2-oleoylglycerol * smiles: ** ccccccccc=ccccccccc(=o)...")
(Created page with "Category:gene == Gene SJ01888 == * transcription-direction: ** positive * right-end-position: ** 88568 * left-end-position: ** 67842 * centisome-position: ** 47.037373...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1812 CPD0-1812] ==
+
== Gene SJ01888 ==
* common-name:
+
* transcription-direction:
** 2-oleoylglycerol
+
** positive
* smiles:
+
* right-end-position:
** ccccccccc=ccccccccc(=o)oc(co)co
+
** 88568
* inchi-key:
+
* left-end-position:
** upwgqkdvauruge-ktkrtigzsa-n
+
** 67842
* molecular-weight:
+
* centisome-position:
** 356.545
+
** 47.037373   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-15088]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-15090]]
+
== Reaction(s) associated ==
* [[RXN-15091]]
+
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=2-oleoylglycerol}}
+
{{#set: transcription-direction=positive}}
{{#set: inchi-key=inchikey=upwgqkdvauruge-ktkrtigzsa-n}}
+
{{#set: right-end-position=88568}}
{{#set: molecular-weight=356.545}}
+
{{#set: left-end-position=67842}}
 +
{{#set: centisome-position=47.037373    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ01888

  • transcription-direction:
    • positive
  • right-end-position:
    • 88568
  • left-end-position:
    • 67842
  • centisome-position:
    • 47.037373

Organism(s) associated with this gene

Reaction(s) associated