Difference between revisions of "SJ01895"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == * common-name: ** (r)-s-lactoylglutathione * sm...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine26-Guanine27-in-tRNAs Guanine26-Guanine27-in-tRNAs] == * common-name: ** a guanine26/gua...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine26-Guanine27-in-tRNAs Guanine26-Guanine27-in-tRNAs] ==
 
* common-name:
 
* common-name:
** (r)-s-lactoylglutathione
+
** a guanine26/guanine27 in trna
* smiles:
 
** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
** vdydcvuwiliyqf-csmhccousa-m
 
* molecular-weight:
 
** 378.376
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLYOXI-RXN]]
+
* [[RXN-12378]]
* [[GLYOXII-RXN]]
+
* [[RXN-12382]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYOXI-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-s-lactoylglutathione}}
+
{{#set: common-name=a guanine26/guanine27 in trna}}
{{#set: inchi-key=inchikey=vdydcvuwiliyqf-csmhccousa-m}}
 
{{#set: molecular-weight=378.376}}
 

Revision as of 09:25, 27 August 2019

Metabolite Guanine26-Guanine27-in-tRNAs

  • common-name:
    • a guanine26/guanine27 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality