Difference between revisions of "SJ01931"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] == * common-name: ** 1-18:1-2-18:1-phosphatidylethanolamine * smiles: ** ccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSYLCERAMIDE-SULFATE GALACTOSYLCERAMIDE-SULFATE] == * common-name: ** a sulfatide == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSYLCERAMIDE-SULFATE GALACTOSYLCERAMIDE-SULFATE] ==
 
* common-name:
 
* common-name:
** 1-18:1-2-18:1-phosphatidylethanolamine
+
** a sulfatide
* smiles:
 
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(occ[n+])([o-])=o)=o
 
* inchi-key:
 
** mwrbnpkjoowzpw-nyvomtagsa-n
 
* molecular-weight:
 
** 744.043
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15036]]
 
* [[RXN-15067]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15036]]
+
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:1-2-18:1-phosphatidylethanolamine}}
+
{{#set: common-name=a sulfatide}}
{{#set: inchi-key=inchikey=mwrbnpkjoowzpw-nyvomtagsa-n}}
 
{{#set: molecular-weight=744.043}}
 

Revision as of 09:23, 27 August 2019

Metabolite GALACTOSYLCERAMIDE-SULFATE

  • common-name:
    • a sulfatide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality