Difference between revisions of "SJ01957"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXIDIZED-GLUTATHIONE OXIDIZED-GLUTATHIONE] == * common-name: ** glutathione disulfide * smiles:...")
(Created page with "Category:gene == Gene SJ01957 == * transcription-direction: ** negative * right-end-position: ** 28617 * left-end-position: ** 23535 * centisome-position: ** 16.406069...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXIDIZED-GLUTATHIONE OXIDIZED-GLUTATHIONE] ==
+
== Gene SJ01957 ==
−
* common-name:
+
* transcription-direction:
−
** glutathione disulfide
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** 28617
−
* inchi-key:
+
* left-end-position:
−
** ypzrwbkmtbyptk-bjdjzhngsa-l
+
** 23535
−
* molecular-weight:
+
* centisome-position:
−
** 610.61
+
** 16.406069   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[GDR]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[GDR_LPAREN_nadp_RPAREN_]]
+
== Reaction(s) associated ==
−
* [[GDR_LPAREN_nadp_RPAREN_h]]
+
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
−
* [[GDR_LPAREN_nadp_RPAREN_m]]
+
** Category: [[annotation]]
−
* [[GDRh]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[GDRm]]
+
{{#set: transcription-direction=negative}}
−
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
+
{{#set: right-end-position=28617}}
−
== Reaction(s) known to produce the compound ==
+
{{#set: left-end-position=23535}}
−
* [[1.11.1.12-RXN]]
+
{{#set: centisome-position=16.406069    }}
−
* [[1.8.4.9-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
−
* [[1.8.5.1-RXN]]
+
{{#set: nb reaction associated=1}}
−
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 
−
* [[GTHP]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=glutathione disulfide}}
 
−
{{#set: inchi-key=inchikey=ypzrwbkmtbyptk-bjdjzhngsa-l}}
 
−
{{#set: molecular-weight=610.61}}
 

Latest revision as of 11:01, 18 March 2021

Gene SJ01957

  • transcription-direction:
    • negative
  • right-end-position:
    • 28617
  • left-end-position:
    • 23535
  • centisome-position:
    • 16.406069

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ01957&oldid=132206"