Difference between revisions of "SJ01957"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXIDIZED-GLUTATHIONE OXIDIZED-GLUTATHIONE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-166 CPD-166] ==
 * common-name:
-** glutathione disulfide
+** a dolichyl &beta;-d-glucosyl phosphate
-* smiles:
-** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
-* inchi-key:
-** ypzrwbkmtbyptk-bjdjzhngsa-l
-* molecular-weight:
-** 610.61
 == Reaction(s) known to consume the compound ==
-* [[GDR]]
+* [[RXN-5470]]
-* [[GDR_LPAREN_nadp_RPAREN_]]
+* [[RXN-5471]]
-* [[GDR_LPAREN_nadp_RPAREN_h]]
+* [[RXN-5472]]
-* [[GDR_LPAREN_nadp_RPAREN_m]]
-* [[GDRh]]
-* [[GDRm]]
-* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[1.11.1.12-RXN]]
+* [[2.4.1.117-RXN]]
-* [[1.8.4.9-RXN]]
-* [[1.8.5.1-RXN]]
-* [[GLUTATHIONE-PEROXIDASE-RXN]]
-* [[GTHP]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=glutathione disulfide}}
+{{#set: common-name=a dolichyl &beta;-d-glucosyl phosphate}}
-{{#set: inchi-key=inchikey=ypzrwbkmtbyptk-bjdjzhngsa-l}}
-{{#set: molecular-weight=610.61}}