Difference between revisions of "SJ02047"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * common-name: ** α,ω...")
(Created page with "Category:gene == Gene SJ02047 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 2.7.10.1-RXN ** Catego...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] ==
+
== Gene SJ02047 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** α,ω-9z-octadecenedioate
+
* [[S.japonica_carotenoid_curated]]
* smiles:
+
== Reaction(s) associated ==
** c(=o)([o-])cccccccc=ccccccccc(=o)[o-]
+
* [[2.7.10.1-RXN]]
* inchi-key:
+
** Category: [[orthology]]
** sblkviqsiheqof-uphrsurjsa-l
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
* [[3.6.4.4-RXN]]
** 310.433
+
** Category: [[orthology]]
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-16418]]
+
* [[PROTEIN-KINASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Category: [[orthology]]
== Reaction(s) of unknown directionality ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: common-name=α,ω-9z-octadecenedioate}}
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
{{#set: inchi-key=inchikey=sblkviqsiheqof-uphrsurjsa-l}}
+
{{#set: nb reaction associated=3}}
{{#set: molecular-weight=310.433}}
 

Latest revision as of 11:00, 18 March 2021

Gene SJ02047

Organism(s) associated with this gene

Reaction(s) associated