Difference between revisions of "SJ02055"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5734-TETRAHYDROXYFLAVONE 5734-TETRAHYDROXYFLAVONE] == * common-name: ** luteolin * smiles: ** c...")
 
(Created page with "Category:gene == Gene SJ02055 == * transcription-direction: ** negative * right-end-position: ** 25603 * left-end-position: ** 13168 * centisome-position: ** 9.222580...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5734-TETRAHYDROXYFLAVONE 5734-TETRAHYDROXYFLAVONE] ==
+
== Gene SJ02055 ==
* common-name:
+
* transcription-direction:
** luteolin
+
** negative
* smiles:
+
* right-end-position:
** c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3)))
+
** 25603
* inchi-key:
+
* left-end-position:
** iqpnaansbpbgfq-uhfffaoysa-m
+
** 13168
* molecular-weight:
+
* centisome-position:
** 285.232
+
** 9.222580   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-7651]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[2.4.1.119-RXN]]
{{#set: common-name=luteolin}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=iqpnaansbpbgfq-uhfffaoysa-m}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=285.232}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-16761]]
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]]
 +
** '''16''' reactions found over '''19''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=25603}}
 +
{{#set: left-end-position=13168}}
 +
{{#set: centisome-position=9.222580    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:00, 18 March 2021

Gene SJ02055

  • transcription-direction:
    • negative
  • right-end-position:
    • 25603
  • left-end-position:
    • 13168
  • centisome-position:
    • 9.222580

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated