Difference between revisions of "SJ02055"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] == * common-name: ** d-ononitol * smiles: ** coc1(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] == * common-name: ** 24-methylenelophenol * smiles: ** cc(c)c(=c)ccc(c)[ch]3...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] ==
 
* common-name:
 
* common-name:
** d-ononitol
+
** 24-methylenelophenol
 
* smiles:
 
* smiles:
** coc1(c(o)c(o)c(o)c(o)c(o)1)
+
** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(c(c)c(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** dscffeyyqksrsv-geskjzqwsa-n
+
** rsmkyrdccsnyfm-aagdoflisa-n
 
* molecular-weight:
 
* molecular-weight:
** 194.184
+
** 412.698
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8281]]
+
* [[2.1.1.143-RXN]]
 +
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-ononitol}}
+
{{#set: common-name=24-methylenelophenol}}
{{#set: inchi-key=inchikey=dscffeyyqksrsv-geskjzqwsa-n}}
+
{{#set: inchi-key=inchikey=rsmkyrdccsnyfm-aagdoflisa-n}}
{{#set: molecular-weight=194.184}}
+
{{#set: molecular-weight=412.698}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-4101

  • common-name:
    • 24-methylenelophenol
  • smiles:
    • cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(c(c)c(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • rsmkyrdccsnyfm-aagdoflisa-n
  • molecular-weight:
    • 412.698

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality