Difference between revisions of "SJ02073"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-6-beta-D-Glucan 1-6-beta-D-Glucan] == * common-name: ** a 1,6-β-d-glucan == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ARGININO-SUCCINATE L-ARGININO-SUCCINATE] == * common-name: ** l-arginino-succinate * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ARGININO-SUCCINATE L-ARGININO-SUCCINATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-arginino-succinate |
| + | * smiles: | ||
| + | ** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+] | ||
| + | * inchi-key: | ||
| + | ** kdzoasgqnopscu-zbhicjrosa-m | ||
| + | * molecular-weight: | ||
| + | ** 289.267 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ARGSUCCINLYA-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ARGSUCCINLYA-RXN]] | ||
| + | * [[ARGSUCCINSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-arginino-succinate}} |
| + | {{#set: inchi-key=inchikey=kdzoasgqnopscu-zbhicjrosa-m}} | ||
| + | {{#set: molecular-weight=289.267}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite L-ARGININO-SUCCINATE
- common-name:
- l-arginino-succinate
- smiles:
- c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+]
- inchi-key:
- kdzoasgqnopscu-zbhicjrosa-m
- molecular-weight:
- 289.267
