Difference between revisions of "SJ02117"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == * common-name: ** nicotinate adenine dinucleotide * smiles: ** c1(c...")
 
(Created page with "Category:gene == Gene SJ17350 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-12086 ** Category:...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] ==
+
== Gene SJ17350 ==
−
* common-name:
+
== Organism(s) associated with this gene  ==
−
** nicotinate adenine dinucleotide
+
* [[S.japonica_carotenoid_curated]]
−
* smiles:
+
== Reaction(s) associated ==
−
** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
+
* [[RXN-12086]]
−
* inchi-key:
+
** Category: [[orthology]]
−
** senpvezbrzqvst-hisdbwnosa-l
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* molecular-weight:
+
* [[RXN-12579]]
−
** 662.399
+
** Category: [[orthology]]
−
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[NAD-SYNTH-GLN-RXN]]
+
* [[TRIACYLGLYCEROL-LIPASE-RXN]]
−
* [[NAD-SYNTH-NH3-RXN]]
+
** Category: [[orthology]]
−
== Reaction(s) known to produce the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[NICONUCADENYLYLTRAN-RXN]]
+
== Pathway(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-6857]]
−
{{#set: common-name=nicotinate adenine dinucleotide}}
+
** '''3''' reactions found over '''7''' reactions in the full pathway
−
{{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}}
+
* [[LIPAS-PWY]]
−
{{#set: molecular-weight=662.399}}
+
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}
 +
{{#set: nb pathway associated=2}}

Revision as of 14:20, 26 August 2019

Gene SJ17350

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6857
    • 3 reactions found over 7 reactions in the full pathway
  • LIPAS-PWY
    • 2 reactions found over 3 reactions in the full pathway


Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ02117&oldid=16249"