Difference between revisions of "SJ02118"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] == * common-name: ** benzoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)ncc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-flavodoxins Oxidized-flavodoxins] == * common-name: ** an oxidized flavodoxin == React...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-flavodoxins Oxidized-flavodoxins] ==
 
* common-name:
 
* common-name:
** benzoyl-coa
+
** an oxidized flavodoxin
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
** vevjtunlalkrno-tyhxjlicsa-j
 
* molecular-weight:
 
** 867.61
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[FLAVONADPREDUCT-RXN]]
 +
* [[PYFLAVOXRE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2006]]
+
* [[FLAVONADPREDUCT-RXN]]
 +
* [[PYFLAVOXRE-RXN]]
 +
* [[RXN-15878]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=benzoyl-coa}}
+
{{#set: common-name=an oxidized flavodoxin}}
{{#set: inchi-key=inchikey=vevjtunlalkrno-tyhxjlicsa-j}}
 
{{#set: molecular-weight=867.61}}
 

Revision as of 09:24, 27 August 2019

Metabolite Oxidized-flavodoxins

  • common-name:
    • an oxidized flavodoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality