Difference between revisions of "SJ02129"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * smiles: ** c([o-...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITACONATE ITACONATE] == * common-name: ** itaconate * smiles: ** c=c(c(=o)[o-])cc([o-])=o * inc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITACONATE ITACONATE] ==
 
* common-name:
 
* common-name:
** (2z,4z)-2-hydroxyhepta-2,4-dienedioate
+
** itaconate
 
* smiles:
 
* smiles:
** c([o-])(=o)cc=cc=c(o)c(=o)[o-]
+
** c=c(c(=o)[o-])cc([o-])=o
 
* inchi-key:
 
* inchi-key:
** zbcbetmbsdtinl-nwjcxacmsa-l
+
** lvhbhzanlowsrm-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 170.121
+
** 128.084
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1K-87]]
+
* [[RXN-8988]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,4z)-2-hydroxyhepta-2,4-dienedioate}}
+
{{#set: common-name=itaconate}}
{{#set: inchi-key=inchikey=zbcbetmbsdtinl-nwjcxacmsa-l}}
+
{{#set: inchi-key=inchikey=lvhbhzanlowsrm-uhfffaoysa-l}}
{{#set: molecular-weight=170.121}}
+
{{#set: molecular-weight=128.084}}

Revision as of 14:19, 26 August 2019

Metabolite ITACONATE

  • common-name:
    • itaconate
  • smiles:
    • c=c(c(=o)[o-])cc([o-])=o
  • inchi-key:
    • lvhbhzanlowsrm-uhfffaoysa-l
  • molecular-weight:
    • 128.084

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality