Difference between revisions of "SJ02145"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == * common-name: ** nicotinate adenine dinucleotide * smiles: ** c1(c...")
(Created page with "Category:gene == Gene SJ00944 == * transcription-direction: ** positive * right-end-position: ** 40304 * left-end-position: ** 36328 * centisome-position: ** 6.501318...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] ==
+
== Gene SJ00944 ==
−
* common-name:
+
* transcription-direction:
−
** nicotinate adenine dinucleotide
+
** positive
−
* smiles:
+
* right-end-position:
−
** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
+
** 40304
−
* inchi-key:
+
* left-end-position:
−
** senpvezbrzqvst-hisdbwnosa-l
+
** 36328
−
* molecular-weight:
+
* centisome-position:
−
** 662.399
+
** 6.501318   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[NAD-SYNTH-GLN-RXN]]
+
* [[S.japonica_sterols_curated]]
−
* [[NAD-SYNTH-NH3-RXN]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[2.8.2.23-RXN]]
−
* [[NICONUCADENYLYLTRAN-RXN]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: common-name=nicotinate adenine dinucleotide}}
+
* [[2.8.2.30-RXN]]
−
{{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}}
+
** Category: [[annotation]]
−
{{#set: molecular-weight=662.399}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-6558]]
 +
** '''7''' reactions found over '''13''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=40304}}
 +
{{#set: left-end-position=36328}}
 +
{{#set: centisome-position=6.501318    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:23, 18 December 2020

Gene SJ00944

  • transcription-direction:
    • positive
  • right-end-position:
    • 40304
  • left-end-position:
    • 36328
  • centisome-position:
    • 6.501318

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6558
    • 7 reactions found over 13 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ02145&oldid=42315"