|
|
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ08856 == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == |
| − | * transcription-direction:
| + | * common-name: |
| − | ** positive
| + | ** nicotinate adenine dinucleotide |
| − | * right-end-position:
| + | * smiles: |
| − | ** 32704
| + | ** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o) |
| − | * left-end-position: | + | * inchi-key: |
| − | ** 17301 | + | ** senpvezbrzqvst-hisdbwnosa-l |
| − | * centisome-position: | + | * molecular-weight: |
| − | ** 36.001 | + | ** 662.399 |
| − | == Organism(s) associated with this gene ==
| + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[NAD-SYNTH-GLN-RXN]] |
| − | == Reaction(s) associated == | + | * [[NAD-SYNTH-NH3-RXN]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to produce the compound == |
| − | * [[ATP-ADENYLYLTRANSFERASE-RXN]]
| + | * [[NICONUCADENYLYLTRAN-RXN]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: common-name=nicotinate adenine dinucleotide}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}} |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| + | {{#set: molecular-weight=662.399}} |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DCTP-PYROPHOSPHATASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[DUTP-PYROP-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[NUCLEOTIDE-PYROPHOSPHATASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14139]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14140]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN0-383]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN0-384]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN0-385]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN0-5107]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN0-6382]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[SULFATE-ADENYLYLTRANSFERASE-ADP-RXN]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | * [[PWY-7206]] | |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7187]]
| |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY0-166]]
| |
| − | ** '''14''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-7184]] | |
| − | ** '''9''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-6545]]
| |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-7821]]
| |
| − | ** '''2''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-5279]] | |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=32704}} | |
| − | {{#set: left-end-position=17301}}
| |
| − | {{#set: centisome-position=36.001 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=12}}
| |
| − | {{#set: nb pathway associated=7}}
| |
