Difference between revisions of "SJ02176"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9868 CPD-9868] == * common-name: ** 3-(all-trans-nonaprenyl)benzene-1,2-diol * smiles: ** c...")
(Created page with "Category:gene == Gene SJ02176 == * transcription-direction: ** positive * right-end-position: ** 274685 * left-end-position: ** 239847 * centisome-position: ** 44.129677...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9868 CPD-9868] ==
+
== Gene SJ02176 ==
* common-name:
+
* transcription-direction:
** 3-(all-trans-nonaprenyl)benzene-1,2-diol
+
** positive
* smiles:
+
* right-end-position:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c
+
** 274685
* inchi-key:
+
* left-end-position:
** pkyzmvivzpjxfm-xbvqzqhusa-n
+
** 239847
* molecular-weight:
+
* centisome-position:
** 723.176
+
** 44.129677   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-9240]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
{{#set: common-name=3-(all-trans-nonaprenyl)benzene-1,2-diol}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=pkyzmvivzpjxfm-xbvqzqhusa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=723.176}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=274685}}
 +
{{#set: left-end-position=239847}}
 +
{{#set: centisome-position=44.129677    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ02176

  • transcription-direction:
    • positive
  • right-end-position:
    • 274685
  • left-end-position:
    • 239847
  • centisome-position:
    • 44.129677

Organism(s) associated with this gene

Reaction(s) associated