Difference between revisions of "SJ02212"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15913 CPD-15913] == * common-name: ** aurachin c epoxide * smiles: ** cc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:gene == Gene SJ22060 == == Organism(s) associated with this gene == * S.japonica_sterols_curated == Reaction(s) associated == * RXN-12086 ** Category: ...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15913 CPD-15913] ==
+
== Gene SJ22060 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** aurachin c epoxide
+
* [[S.japonica_sterols_curated]]
* smiles:
+
== Reaction(s) associated ==
** cc(c)=cccc(c)=cccc(c)=ccc12(oc(c)1n(c3(c=cc=cc(c2=o)=3))o)
+
* [[RXN-12086]]
* inchi-key:
+
** Category: [[orthology]]
** forhhprbeftlrm-yefhwucqsa-n
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
* [[RXN-12579]]
** 395.541
+
** Category: [[orthology]]
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) known to produce the compound ==
+
* [[TRIACYLGLYCEROL-LIPASE-RXN]]
* [[RXN-15029]]
+
** Category: [[orthology]]
== Reaction(s) of unknown directionality ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: common-name=aurachin c epoxide}}
+
== Pathway(s) associated ==
{{#set: inchi-key=inchikey=forhhprbeftlrm-yefhwucqsa-n}}
+
* [[PWY-6857]]
{{#set: molecular-weight=395.541}}
+
** '''3''' reactions found over '''7''' reactions in the full pathway
 +
* [[LIPAS-PWY]]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}
 +
{{#set: nb pathway associated=2}}

Revision as of 20:22, 18 December 2020

Gene SJ22060

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6857
    • 3 reactions found over 7 reactions in the full pathway
  • LIPAS-PWY
    • 2 reactions found over 3 reactions in the full pathway