Difference between revisions of "SJ02256"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3709 CPD-3709] == * common-name: ** guanosine 2',3'-cyclic monophosphate * smiles: ** c(o)c...")
(Created page with "Category:gene == Gene SJ02256 == * transcription-direction: ** negative * right-end-position: ** 10693 * left-end-position: ** 8909 * centisome-position: ** 1.6400476...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3709 CPD-3709] ==
+
== Gene SJ02256 ==
−
* common-name:
+
* transcription-direction:
−
** guanosine 2',3'-cyclic monophosphate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)))
+
** 10693
−
* inchi-key:
+
* left-end-position:
−
** uasryodfrywbrc-uuokfmhzsa-m
+
** 8909
−
* molecular-weight:
+
* centisome-position:
−
** 344.2
+
** 1.6400476   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-12058]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[3.1.3.16-RXN]]
−
{{#set: common-name=guanosine 2',3'-cyclic monophosphate}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=uasryodfrywbrc-uuokfmhzsa-m}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=344.2}}
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=10693}}
 +
{{#set: left-end-position=8909}}
 +
{{#set: centisome-position=1.6400476    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:02, 18 March 2021

Gene SJ02256

  • transcription-direction:
    • negative
  • right-end-position:
    • 10693
  • left-end-position:
    • 8909
  • centisome-position:
    • 1.6400476

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ02256&oldid=132518"